C16H20N6O3 — CID 123804497
2-amino-6-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]hexanoic acid (PubChem CID 123804497) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-amino-6-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]hexanoic acid.
| Compound Name | 2-amino-6-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 123804497 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-amino-6-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]hexanoic acid |
| SMILES | NC(CCCCNC(=O)Cc1ccc(-c2nncnn2)cc1)C(=O)O |
| InChI | InChI=1S/C16H20N6O3/c17-13(16(24)25)3-1-2-8-18-14(23)9-11-4-6-12(7-5-11)15-21-19-10-20-22-15/h4-7,10,13H,1-3,8-9,17H2,(H,18,23)(H,24,25) |
| InChIKey | NCVOFWOCDPGYHP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|