C15H19N5O3 — CID 176885026
(2S)-2-amino-6-[(3-phenyl-1,2,4-triazole-1-carbonyl)amino]hexanoic acid (PubChem CID 176885026) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is (2S)-2-amino-6-[(3-phenyl-1,2,4-triazole-1-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(3-phenyl-1,2,4-triazole-1-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 176885026 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (2S)-2-amino-6-[(3-phenyl-1,2,4-triazole-1-carbonyl)amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)n1cnc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C15H19N5O3/c16-12(14(21)22)8-4-5-9-17-15(23)20-10-18-13(19-20)11-6-2-1-3-7-11/h1-3,6-7,10,12H,4-5,8-9,16H2,(H,17,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | MDGFXIVNRZGOMR-LBPRGKRZSA-N |
| XLogP | 1.09 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|