About (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline
(2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline (PubChem CID 174469360) has the molecular formula C19H30N4O2
and a molecular weight of 346.48 g/mol. Its IUPAC name is (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline.
Molecular Properties
| Compound Name | (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline |
| PubChem CID | 174469360 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline |
| SMILES | CCCCCNCCCC[C@H](N)C(=O)O.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C11H24N2O2.C8H6N2/c1-2-3-5-8-13-9-6-4-7-10(12)11(14)15;1-2-4-8-7(3-1)9-5-6-10-8/h10,13H,2-9,12H2,1H3,(H,14,15);1-6H/t10-;/m0./s1 |
| InChIKey | WAUFDVLSAOCRTE-PPHPATTJSA-N |
| XLogP | 2.98 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline?
The IUPAC name of (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline (CID 174469360) is (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline.
What is the SMILES notation for (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline?
The canonical SMILES for (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline is CCCCCNCCCC[C@H](N)C(=O)O.c1ccc2nccnc2c1.
What is the InChIKey of (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline?
The InChIKey is WAUFDVLSAOCRTE-PPHPATTJSA-N. The full InChI is InChI=1S/C11H24N2O2.C8H6N2/c1-2-3-5-8-13-9-6-4-7-10(12)11(14)15;1-2-4-8-7(3-1)9-5-6-10-8/h10,13H,2-9,12H2,1H3,(H,14,15);1-6H/t10-;/m0./s1.
What are the key properties of (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline?
(2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline has a molecular weight of 346.48 g/mol, XLogP of 2.98, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-6-(pentylamino)hexanoic acid;quinoxaline is sourced from PubChem (CID 174469360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).