C20H40N2O3 — CID 6454263
(2S)-2-amino-6-(tetradecanoylamino)hexanoic acid (PubChem CID 6454263) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is (2S)-2-amino-6-(tetradecanoylamino)hexanoic acid.
| Compound Name | (2S)-2-amino-6-(tetradecanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 6454263 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | (2S)-2-amino-6-(tetradecanoylamino)hexanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H40N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-16-19(23)22-17-14-13-15-18(21)20(24)25/h18H,2-17,21H2,1H3,(H,22,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | XTLFOGNEQSPWGW-SFHVURJKSA-N |
| XLogP | 4.39 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|