C25H53N5O2 — CID 159397437
N-[(5S)-5-amino-6-[3-[4-(butylamino)butylamino]propylamino]-6-oxohexyl]octanamide (PubChem CID 159397437) has the molecular formula C25H53N5O2 and a molecular weight of 455.73 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-[3-[4-(butylamino)butylamino]propylamino]-6-oxohexyl]octanamide.
| Compound Name | N-[(5S)-5-amino-6-[3-[4-(butylamino)butylamino]propylamino]-6-oxohexyl]octanamide |
|---|---|
| PubChem CID | 159397437 |
| Molecular Formula | C25H53N5O2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.42 |
| IUPAC Name | N-[(5S)-5-amino-6-[3-[4-(butylamino)butylamino]propylamino]-6-oxohexyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCCC[C@H](N)C(=O)NCCCNCCCCNCCCC |
| InChI | InChI=1S/C25H53N5O2/c1-3-5-7-8-9-16-24(31)29-21-11-10-15-23(26)25(32)30-22-14-20-28-19-13-12-18-27-17-6-4-2/h23,27-28H,3-22,26H2,1-2H3,(H,29,31)(H,30,32)/t23-/m0/s1 |
| InChIKey | LMXJALKGORGMEI-QHCPKHFHSA-N |
| XLogP | 3.23 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|