C23H42N4O4 — CID 142928631
2-amino-6-(2,5-dioxopyrrol-1-yl)-N-[5-(hexylamino)-5-oxopentyl]hexanamide;ethane (PubChem CID 142928631) has the molecular formula C23H42N4O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-amino-6-(2,5-dioxopyrrol-1-yl)-N-[5-(hexylamino)-5-oxopentyl]hexanamide;ethane.
| Compound Name | 2-amino-6-(2,5-dioxopyrrol-1-yl)-N-[5-(hexylamino)-5-oxopentyl]hexanamide;ethane |
|---|---|
| PubChem CID | 142928631 |
| Molecular Formula | C23H42N4O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 2-amino-6-(2,5-dioxopyrrol-1-yl)-N-[5-(hexylamino)-5-oxopentyl]hexanamide;ethane |
| SMILES | CC.CCCCCCNC(=O)CCCCNC(=O)C(N)CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H36N4O4.C2H6/c1-2-3-4-7-14-23-18(26)11-5-8-15-24-21(29)17(22)10-6-9-16-25-19(27)12-13-20(25)28;1-2/h12-13,17H,2-11,14-16,22H2,1H3,(H,23,26)(H,24,29);1-2H3 |
| InChIKey | AFTRKPGXQBHIMD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|