C21H34N4O5 — CID 20719178
6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-methylhexanamide (PubChem CID 20719178) has the molecular formula C21H34N4O5 and a molecular weight of 422.53 g/mol. Its IUPAC name is 6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-methylhexanamide.
| Compound Name | 6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-methylhexanamide |
|---|---|
| PubChem CID | 20719178 |
| Molecular Formula | C21H34N4O5 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H34N4O5/c1-22-17(26)9-4-2-6-14-23-18(27)10-5-3-7-15-24-19(28)11-8-16-25-20(29)12-13-21(25)30/h12-13H,2-11,14-16H2,1H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | UPHQCTJNXAWGDM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|