C23H41N3O4 — CID 145076573
6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperidin-1-ylhexyl)hexanamide;ethane;molecular hydrogen (PubChem CID 145076573) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperidin-1-ylhexyl)hexanamide;ethane;molecular hydrogen.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperidin-1-ylhexyl)hexanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 145076573 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperidin-1-ylhexyl)hexanamide;ethane;molecular hydrogen |
| SMILES | CC.O=C(CCCCCN1C(=O)C=CC1=O)NCCCCCC(=O)N1CCCCC1.[H][H] |
| InChI | InChI=1S/C21H33N3O4.C2H6.H2/c25-18(10-4-2-9-17-24-20(27)12-13-21(24)28)22-14-6-1-5-11-19(26)23-15-7-3-8-16-23;1-2;/h12-13H,1-11,14-17H2,(H,22,25);1-2H3;1H |
| InChIKey | KMSZLDRTEGAJED-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|