C26H47N3O4 — CID 145076823
ethane;molecular hydrogen;1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 145076823) has the molecular formula C26H47N3O4 and a molecular weight of 465.68 g/mol. Its IUPAC name is ethane;molecular hydrogen;1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione.
| Compound Name | ethane;molecular hydrogen;1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145076823 |
| Molecular Formula | C26H47N3O4 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | ethane;molecular hydrogen;1-[[4-[[(6-oxo-6-piperidin-1-ylhexyl)amino]methoxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | CC.O=C(CCCCCNCOCC1CCC(CN2C(=O)C=CC2=O)CC1)N1CCCCC1.[H][H] |
| InChI | InChI=1S/C24H39N3O4.C2H6.H2/c28-22(26-15-5-2-6-16-26)7-3-1-4-14-25-19-31-18-21-10-8-20(9-11-21)17-27-23(29)12-13-24(27)30;1-2;/h12-13,20-21,25H,1-11,14-19H2;1-2H3;1H |
| InChIKey | TTYHQJUQGANMBS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|