C27H49N3O4 — CID 145077060
4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[6-[(4-methylpiperidin-1-yl)methoxy]hexyl]cyclohexane-1-carboxamide;ethane;molecular hydrogen (PubChem CID 145077060) has the molecular formula C27H49N3O4 and a molecular weight of 479.71 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[6-[(4-methylpiperidin-1-yl)methoxy]hexyl]cyclohexane-1-carboxamide;ethane;molecular hydrogen.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[6-[(4-methylpiperidin-1-yl)methoxy]hexyl]cyclohexane-1-carboxamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 145077060 |
| Molecular Formula | C27H49N3O4 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.37 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[6-[(4-methylpiperidin-1-yl)methoxy]hexyl]cyclohexane-1-carboxamide;ethane;molecular hydrogen |
| SMILES | CC.CC1CCN(COCCCCCCNC(=O)C2CCC(CN3C(=O)C=CC3=O)CC2)CC1.[H][H] |
| InChI | InChI=1S/C25H41N3O4.C2H6.H2/c1-20-12-15-27(16-13-20)19-32-17-5-3-2-4-14-26-25(31)22-8-6-21(7-9-22)18-28-23(29)10-11-24(28)30;1-2;/h10-11,20-22H,2-9,12-19H2,1H3,(H,26,31);1-2H3;1H |
| InChIKey | QTPDUODCZKCZTC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|