C24H38N4O7 — CID 157128199
2-[3-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]propyl]-N,N'-bis(3-hydroxypropyl)propanediamide (PubChem CID 157128199) has the molecular formula C24H38N4O7 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-[3-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]propyl]-N,N'-bis(3-hydroxypropyl)propanediamide.
| Compound Name | 2-[3-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]propyl]-N,N'-bis(3-hydroxypropyl)propanediamide |
|---|---|
| PubChem CID | 157128199 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-[3-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]propyl]-N,N'-bis(3-hydroxypropyl)propanediamide |
| SMILES | O=C(NCCCC(C(=O)NCCCO)C(=O)NCCCO)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C24H38N4O7/c29-14-2-12-26-23(34)19(24(35)27-13-3-15-30)4-1-11-25-22(33)18-7-5-17(6-8-18)16-28-20(31)9-10-21(28)32/h9-10,17-19,29-30H,1-8,11-16H2,(H,25,33)(H,26,34)(H,27,35) |
| InChIKey | XMYGRCUJAAZXJE-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|