C20H29N3O4S3 — CID 167250486
4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[2-(2-ethylsulfanylcarbothioylsulfanylpropanoylamino)ethyl]cyclohexane-1-carboxamide (PubChem CID 167250486) has the molecular formula C20H29N3O4S3 and a molecular weight of 471.67 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[2-(2-ethylsulfanylcarbothioylsulfanylpropanoylamino)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[2-(2-ethylsulfanylcarbothioylsulfanylpropanoylamino)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167250486 |
| Molecular Formula | C20H29N3O4S3 |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[2-(2-ethylsulfanylcarbothioylsulfanylpropanoylamino)ethyl]cyclohexane-1-carboxamide |
| SMILES | CCSC(=S)SC(C)C(=O)NCCNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C20H29N3O4S3/c1-3-29-20(28)30-13(2)18(26)21-10-11-22-19(27)15-6-4-14(5-7-15)12-23-16(24)8-9-17(23)25/h8-9,13-15H,3-7,10-12H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | BDFUMJKXXMJGRU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|