C22H34N2O3 — CID 138492356
N-cyclodecyl-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 138492356) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-cyclodecyl-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-cyclodecyl-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 138492356 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | N-cyclodecyl-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NC1CCCCCCCCC1)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C22H34N2O3/c25-20-14-15-21(26)24(20)16-17-10-12-18(13-11-17)22(27)23-19-8-6-4-2-1-3-5-7-9-19/h14-15,17-19H,1-13,16H2,(H,23,27) |
| InChIKey | AXXWZFAYAYFGRO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|