C23H28N2O7 — CID 57225103
bis[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] carbonate (PubChem CID 57225103) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is bis[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] carbonate.
| Compound Name | bis[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] carbonate |
|---|---|
| PubChem CID | 57225103 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | bis[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] carbonate |
| SMILES | O=C(OC1CCC(CN2C(=O)C=CC2=O)CC1)OC1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C23H28N2O7/c26-19-9-10-20(27)24(19)13-15-1-5-17(6-2-15)31-23(30)32-18-7-3-16(4-8-18)14-25-21(28)11-12-22(25)29/h9-12,15-18H,1-8,13-14H2 |
| InChIKey | RDUJGQPSAPPYGE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|