C21H31BN2O5 — CID 158801537
CID 158801537 (PubChem CID 158801537) has the molecular formula C21H31BN2O5 and a molecular weight of 402.30 g/mol.
| Compound Name | CID 158801537 |
|---|---|
| PubChem CID | 158801537 |
| Molecular Formula | C21H31BN2O5 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | — |
| SMILES | O=C(O)C1CCC(CNC(=O)C2CCC(CN3C(=O)C=CC3=O)CC2)CC1.[B]C |
| InChI | InChI=1S/C20H28N2O5.CH3B/c23-17-9-10-18(24)22(17)12-14-3-5-15(6-4-14)19(25)21-11-13-1-7-16(8-2-13)20(26)27;1-2/h9-10,13-16H,1-8,11-12H2,(H,21,25)(H,26,27);1H3 |
| InChIKey | ZLTKEWLNKDJYDU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|