C12H15NO7S — CID 54540677
sulfo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 54540677) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is sulfo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | sulfo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54540677 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | sulfo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(OS(=O)(=O)O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H15NO7S/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)20-21(17,18)19/h5-6,8-9H,1-4,7H2,(H,17,18,19) |
| InChIKey | ZCYVPQSIZOVNSZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|