C23H35N3O7 — CID 176610974
2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 176610974) has the molecular formula C23H35N3O7 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 176610974 |
| Molecular Formula | C23H35N3O7 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)C(=O)O |
| InChI | InChI=1S/C23H35N3O7/c1-23(2,3)33-22(32)24-13-5-4-6-17(21(30)31)25-20(29)16-9-7-15(8-10-16)14-26-18(27)11-12-19(26)28/h11-12,15-17H,4-10,13-14H2,1-3H3,(H,24,32)(H,25,29)(H,30,31) |
| InChIKey | OSNIFGIHJBUIEB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|