C28H44N4O6 — CID 118287880
tert-butyl (3R)-3-[[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 118287880) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118287880 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | tert-butyl (3R)-3-[[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](CNC(=O)CCCCCNC(=O)C2CCC(CN3C(=O)C=CC3=O)CC2)C1 |
| InChI | InChI=1S/C28H44N4O6/c1-28(2,3)38-27(37)31-16-14-21(18-31)17-30-23(33)7-5-4-6-15-29-26(36)22-10-8-20(9-11-22)19-32-24(34)12-13-25(32)35/h12-13,20-22H,4-11,14-19H2,1-3H3,(H,29,36)(H,30,33)/t20?,21-,22?/m1/s1 |
| InChIKey | YEJTUCJJDJQUQC-ATKRNPRHSA-N |
| XLogP | 2.77 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|