C26H42N4O6 — CID 123856873
tert-butyl 3-[[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 123856873) has the molecular formula C26H42N4O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is tert-butyl 3-[[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123856873 |
| Molecular Formula | C26H42N4O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | tert-butyl 3-[[6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)CCCCCNC(=O)CCCCCN2C(=O)C=CC2=O)C1 |
| InChI | InChI=1S/C26H42N4O6/c1-26(2,3)36-25(35)29-17-14-20(19-29)18-28-22(32)11-6-4-8-15-27-21(31)10-7-5-9-16-30-23(33)12-13-24(30)34/h12-13,20H,4-11,14-19H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | WRGMKIJRLOFRTI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|