C15H23N3O3 — CID 90065514
6-(2,5-dioxopyrrol-1-yl)-N-[[(3S)-pyrrolidin-3-yl]methyl]hexanamide (PubChem CID 90065514) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[[(3S)-pyrrolidin-3-yl]methyl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[[(3S)-pyrrolidin-3-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 90065514 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[[(3S)-pyrrolidin-3-yl]methyl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)NC[C@H]1CCNC1 |
| InChI | InChI=1S/C15H23N3O3/c19-13(17-11-12-7-8-16-10-12)4-2-1-3-9-18-14(20)5-6-15(18)21/h5-6,12,16H,1-4,7-11H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | VQOOTHGAADMYNY-LBPRGKRZSA-N |
| XLogP | 0.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|