C13H19N3O5 — CID 121412813
2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylcarbamic acid (PubChem CID 121412813) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylcarbamic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 121412813 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H19N3O5/c17-10(14-7-8-15-13(20)21)4-2-1-3-9-16-11(18)5-6-12(16)19/h5-6,15H,1-4,7-9H2,(H,14,17)(H,20,21) |
| InChIKey | BRUSSWNFMFXCCJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|