C27H37N5O8 — CID 134496669
2-[1-[4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]phenyl]ethylideneamino]oxyethylcarbamic acid (PubChem CID 134496669) has the molecular formula C27H37N5O8 and a molecular weight of 559.62 g/mol. Its IUPAC name is 2-[1-[4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]phenyl]ethylideneamino]oxyethylcarbamic acid.
| Compound Name | 2-[1-[4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]phenyl]ethylideneamino]oxyethylcarbamic acid |
|---|---|
| PubChem CID | 134496669 |
| Molecular Formula | C27H37N5O8 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 2-[1-[4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]phenyl]ethylideneamino]oxyethylcarbamic acid |
| SMILES | CC(=NOCCNC(=O)O)c1ccc(OCCCC(=O)NCCNC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C27H37N5O8/c1-20(31-40-19-16-30-27(37)38)21-8-10-22(11-9-21)39-18-5-7-24(34)29-15-14-28-23(33)6-3-2-4-17-32-25(35)12-13-26(32)36/h8-13,30H,2-7,14-19H2,1H3,(H,28,33)(H,29,34)(H,37,38) |
| InChIKey | JEPFFAKMDBTFQS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 175.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|