C24H35N3O4 — CID 134496658
N-[2-[4-(4-acetylphenoxy)butanoylamino]ethyl]-6-(2,5-dihydropyrrol-1-yl)hexanamide (PubChem CID 134496658) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[2-[4-(4-acetylphenoxy)butanoylamino]ethyl]-6-(2,5-dihydropyrrol-1-yl)hexanamide.
| Compound Name | N-[2-[4-(4-acetylphenoxy)butanoylamino]ethyl]-6-(2,5-dihydropyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 134496658 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | N-[2-[4-(4-acetylphenoxy)butanoylamino]ethyl]-6-(2,5-dihydropyrrol-1-yl)hexanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)NCCNC(=O)CCCCCN2CC=CC2)cc1 |
| InChI | InChI=1S/C24H35N3O4/c1-20(28)21-10-12-22(13-11-21)31-19-7-9-24(30)26-15-14-25-23(29)8-3-2-4-16-27-17-5-6-18-27/h5-6,10-13H,2-4,7-9,14-19H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | ZKLBWHUYTLYORJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|