C18H25NO6 — CID 2950389
oxalic acid;1-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]ethanone (PubChem CID 2950389) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is oxalic acid;1-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]ethanone.
| Compound Name | oxalic acid;1-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 2950389 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | oxalic acid;1-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCCN2CCCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H23NO2.C2H2O4/c1-14(18)15-6-8-16(9-7-15)19-13-5-4-12-17-10-2-3-11-17;3-1(4)2(5)6/h6-9H,2-5,10-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | FVPYNPJLDDGSLD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|