C22H35NO5 — CID 2922263
1-[4-[4-(2-methylbutan-2-yl)phenoxy]butyl]piperidine;oxalic acid (PubChem CID 2922263) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-[4-[4-(2-methylbutan-2-yl)phenoxy]butyl]piperidine;oxalic acid.
| Compound Name | 1-[4-[4-(2-methylbutan-2-yl)phenoxy]butyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 2922263 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 1-[4-[4-(2-methylbutan-2-yl)phenoxy]butyl]piperidine;oxalic acid |
| SMILES | CCC(C)(C)c1ccc(OCCCCN2CCCCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H33NO.C2H2O4/c1-4-20(2,3)18-10-12-19(13-11-18)22-17-9-8-16-21-14-6-5-7-15-21;3-1(4)2(5)6/h10-13H,4-9,14-17H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | JHTHTQXXWVZSTL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|