C21H33NO5 — CID 2923350
1-[3-(4-tert-butyl-2-methylphenoxy)propyl]piperidine;oxalic acid (PubChem CID 2923350) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-[3-(4-tert-butyl-2-methylphenoxy)propyl]piperidine;oxalic acid.
| Compound Name | 1-[3-(4-tert-butyl-2-methylphenoxy)propyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 2923350 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-[3-(4-tert-butyl-2-methylphenoxy)propyl]piperidine;oxalic acid |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCCCN1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H31NO.C2H2O4/c1-16-15-17(19(2,3)4)9-10-18(16)21-14-8-13-20-11-6-5-7-12-20;3-1(4)2(5)6/h9-10,15H,5-8,11-14H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | QAISCIDHZJMFPN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|