C23H37NO6 — CID 2924003
1-[2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl]-4-methylpiperidine;oxalic acid (PubChem CID 2924003) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-[2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl]-4-methylpiperidine;oxalic acid.
| Compound Name | 1-[2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl]-4-methylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 2924003 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 1-[2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]ethyl]-4-methylpiperidine;oxalic acid |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCCOCCN1CCC(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H35NO2.C2H2O4/c1-17-8-10-22(11-9-17)12-13-23-14-15-24-20-7-6-19(16-18(20)2)21(3,4)5;3-1(4)2(5)6/h6-7,16-17H,8-15H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | FLCFIUPIQPQOHA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|