C20H33NO2 — CID 2086476
(2R)-1-(4-tert-butyl-2-methylphenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 2086476) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (2R)-1-(4-tert-butyl-2-methylphenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(4-tert-butyl-2-methylphenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 2086476 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (2R)-1-(4-tert-butyl-2-methylphenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC[C@H](O)CN1CCC(C)CC1 |
| InChI | InChI=1S/C20H33NO2/c1-15-8-10-21(11-9-15)13-18(22)14-23-19-7-6-17(12-16(19)2)20(3,4)5/h6-7,12,15,18,22H,8-11,13-14H2,1-5H3/t18-/m1/s1 |
| InChIKey | UBQRGLZNVLIMRZ-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |