C16H24N2O4 — CID 109415985
1-(2-methyl-5-nitrophenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 109415985) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(2-methyl-5-nitrophenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1-(2-methyl-5-nitrophenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 109415985 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-(2-methyl-5-nitrophenoxy)-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | Cc1ccc([N+](=O)[O-])cc1OCC(O)CN1CCC(C)CC1 |
| InChI | InChI=1S/C16H24N2O4/c1-12-5-7-17(8-6-12)10-15(19)11-22-16-9-14(18(20)21)4-3-13(16)2/h3-4,9,12,15,19H,5-8,10-11H2,1-2H3 |
| InChIKey | AOSBVRCVBDFPCD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|