1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid

C16H21BrClNO5 — CID 2924033

IUPAC1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid
SMILESClc1cc(Br)ccc1OCCCN1CCCCC1.O=C(O)C(=O)O
InChIInChI=1S/C14H19BrClNO.C2H2O4/c15-12-5-6-14(13(16)11-12)18-10-4-9-17-7-2-1-3-8-17;3-1(4)2(5)6/h5-6,11H,1-4,7-10H2;(H,3,4)(H,5,6)
InChIKeyBNDDJMFVDZDXCI-UHFFFAOYSA-N
MW422.70 g/mol
LogP3.51
Rot. Bonds5

About 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid

1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid (PubChem CID 2924033) has the molecular formula C16H21BrClNO5 and a molecular weight of 422.70 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid.

Molecular Properties

Compound Name1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid
PubChem CID2924033
Molecular FormulaC16H21BrClNO5
Molecular Weight422.70 g/mol
Exact Mass421.03
IUPAC Name1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid
SMILESClc1cc(Br)ccc1OCCCN1CCCCC1.O=C(O)C(=O)O
InChIInChI=1S/C14H19BrClNO.C2H2O4/c15-12-5-6-14(13(16)11-12)18-10-4-9-17-7-2-1-3-8-17;3-1(4)2(5)6/h5-6,11H,1-4,7-10H2;(H,3,4)(H,5,6)
InChIKeyBNDDJMFVDZDXCI-UHFFFAOYSA-N
XLogP3.51
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500422.70
LogP ≤ 53.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid?
The IUPAC name of 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid (CID 2924033) is 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid.
What is the SMILES notation for 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid?
The canonical SMILES for 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid is Clc1cc(Br)ccc1OCCCN1CCCCC1.O=C(O)C(=O)O.
What is the InChIKey of 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid?
The InChIKey is BNDDJMFVDZDXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrClNO.C2H2O4/c15-12-5-6-14(13(16)11-12)18-10-4-9-17-7-2-1-3-8-17;3-1(4)2(5)6/h5-6,11H,1-4,7-10H2;(H,3,4)(H,5,6).
What are the key properties of 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid?
1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid has a molecular weight of 422.70 g/mol, XLogP of 3.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-bromo-2-chlorophenoxy)propyl]piperidine;oxalic acid is sourced from PubChem (CID 2924033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).