1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid

C19H28BrNO5 — CID 146051025

IUPAC1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid
SMILESBrc1ccc(OCCCCCCN2CCCCC2)cc1.O=C(O)C(=O)O
InChIInChI=1S/C17H26BrNO.C2H2O4/c18-16-8-10-17(11-9-16)20-15-7-2-1-4-12-19-13-5-3-6-14-19;3-1(4)2(5)6/h8-11H,1-7,12-15H2;(H,3,4)(H,5,6)
InChIKeyQCXXDDGFLZEQFS-UHFFFAOYSA-N
MW430.34 g/mol
LogP4.03
Rot. Bonds8

About 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid

1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid (PubChem CID 146051025) has the molecular formula C19H28BrNO5 and a molecular weight of 430.34 g/mol. Its IUPAC name is 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid.

Molecular Properties

Compound Name1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid
PubChem CID146051025
Molecular FormulaC19H28BrNO5
Molecular Weight430.34 g/mol
Exact Mass429.12
IUPAC Name1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid
SMILESBrc1ccc(OCCCCCCN2CCCCC2)cc1.O=C(O)C(=O)O
InChIInChI=1S/C17H26BrNO.C2H2O4/c18-16-8-10-17(11-9-16)20-15-7-2-1-4-12-19-13-5-3-6-14-19;3-1(4)2(5)6/h8-11H,1-7,12-15H2;(H,3,4)(H,5,6)
InChIKeyQCXXDDGFLZEQFS-UHFFFAOYSA-N
XLogP4.03
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500430.34
LogP ≤ 54.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid?
The IUPAC name of 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid (CID 146051025) is 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid.
What is the SMILES notation for 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid?
The canonical SMILES for 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid is Brc1ccc(OCCCCCCN2CCCCC2)cc1.O=C(O)C(=O)O.
What is the InChIKey of 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid?
The InChIKey is QCXXDDGFLZEQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26BrNO.C2H2O4/c18-16-8-10-17(11-9-16)20-15-7-2-1-4-12-19-13-5-3-6-14-19;3-1(4)2(5)6/h8-11H,1-7,12-15H2;(H,3,4)(H,5,6).
What are the key properties of 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid?
1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid has a molecular weight of 430.34 g/mol, XLogP of 4.03, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(4-bromophenoxy)hexyl]piperidine;oxalic acid is sourced from PubChem (CID 146051025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).