C16H23BrClN3O3 — CID 108882401
1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 108882401) has the molecular formula C16H23BrClN3O3 and a molecular weight of 420.74 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 108882401 |
| Molecular Formula | C16H23BrClN3O3 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | O=C(NCCCOc1ccc(Br)cc1Cl)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H23BrClN3O3/c17-13-2-3-15(14(18)12-13)24-9-1-4-19-16(22)20-5-6-21-7-10-23-11-8-21/h2-3,12H,1,4-11H2,(H2,19,20,22) |
| InChIKey | ZEOVVJPCZCRRRC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|