C21H25BrClN3O2 — CID 108882485
1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 108882485) has the molecular formula C21H25BrClN3O2 and a molecular weight of 466.81 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 108882485 |
| Molecular Formula | C21H25BrClN3O2 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | O=C(NCCCOc1ccc(Br)cc1Cl)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25BrClN3O2/c22-16-5-10-20(19(23)15-16)28-14-4-11-24-21(27)25-17-6-8-18(9-7-17)26-12-2-1-3-13-26/h5-10,15H,1-4,11-14H2,(H2,24,25,27) |
| InChIKey | CHKBVJYSOMQDPC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|