C16H15BrCl2N2O2 — CID 108882394
1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-chlorophenyl)urea (PubChem CID 108882394) has the molecular formula C16H15BrCl2N2O2 and a molecular weight of 418.12 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 108882394 |
| Molecular Formula | C16H15BrCl2N2O2 |
| Molecular Weight | 418.12 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-chlorophenyl)urea |
| SMILES | O=C(NCCCOc1ccc(Br)cc1Cl)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15BrCl2N2O2/c17-11-5-6-15(14(19)9-11)23-8-2-7-20-16(22)21-13-4-1-3-12(18)10-13/h1,3-6,9-10H,2,7-8H2,(H2,20,21,22) |
| InChIKey | IJUKXMDNUYRBBB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.12 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|