C14H20BrClN2O3 — CID 108882472
1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 108882472) has the molecular formula C14H20BrClN2O3 and a molecular weight of 379.68 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 108882472 |
| Molecular Formula | C14H20BrClN2O3 |
| Molecular Weight | 379.68 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)NCCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H20BrClN2O3/c1-2-11(9-19)18-14(20)17-6-3-7-21-13-5-4-10(15)8-12(13)16/h4-5,8,11,19H,2-3,6-7,9H2,1H3,(H2,17,18,20) |
| InChIKey | GXCYFVJBAZMLHX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|