C22H26BrClN2O2 — CID 108882363
1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea (PubChem CID 108882363) has the molecular formula C22H26BrClN2O2 and a molecular weight of 465.82 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea.
| Compound Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 108882363 |
| Molecular Formula | C22H26BrClN2O2 |
| Molecular Weight | 465.82 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)NCCCOc1ccc(Br)cc1Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H26BrClN2O2/c1-15(17-8-7-16-5-2-3-6-18(16)13-17)26-22(27)25-11-4-12-28-21-10-9-19(23)14-20(21)24/h7-10,13-15H,2-6,11-12H2,1H3,(H2,25,26,27) |
| InChIKey | OZWUUGNYNJYISJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|