C27H37BrN2O2 — CID 108881989
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea (PubChem CID 108881989) has the molecular formula C27H37BrN2O2 and a molecular weight of 501.51 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108881989 |
| Molecular Formula | C27H37BrN2O2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)NCCCOc1ccc(C(C)(C)C)cc1Br)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H37BrN2O2/c1-5-24(21-12-11-19-9-6-7-10-20(19)17-21)30-26(31)29-15-8-16-32-25-14-13-22(18-23(25)28)27(2,3)4/h11-14,17-18,24H,5-10,15-16H2,1-4H3,(H2,29,30,31) |
| InChIKey | QBEPVIABBBHYSU-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|