C23H29ClN2O2 — CID 108883405
1-[3-(2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea (PubChem CID 108883405) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea.
| Compound Name | 1-[3-(2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108883405 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)NCCCOc1ccccc1Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H29ClN2O2/c1-2-21(19-13-12-17-8-3-4-9-18(17)16-19)26-23(27)25-14-7-15-28-22-11-6-5-10-20(22)24/h5-6,10-13,16,21H,2-4,7-9,14-15H2,1H3,(H2,25,26,27) |
| InChIKey | MKQHUFJFWDCGJG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|