C20H23FN2O — CID 108866819
1-(2-fluorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea (PubChem CID 108866819) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108866819 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)Nc1ccccc1F)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H23FN2O/c1-2-18(16-12-11-14-7-3-4-8-15(14)13-16)22-20(24)23-19-10-6-5-9-17(19)21/h5-6,9-13,18H,2-4,7-8H2,1H3,(H2,22,23,24) |
| InChIKey | BVJRWYVGDNGZRT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |