C22H25N3O3 — CID 108510820
N-(2-carbamoylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide (PubChem CID 108510820) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide.
| Compound Name | N-(2-carbamoylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
|---|---|
| PubChem CID | 108510820 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-(2-carbamoylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]oxamide |
| SMILES | CCC(NC(=O)C(=O)Nc1ccccc1C(N)=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H25N3O3/c1-2-18(16-12-11-14-7-3-4-8-15(14)13-16)24-21(27)22(28)25-19-10-6-5-9-17(19)20(23)26/h5-6,9-13,18H,2-4,7-8H2,1H3,(H2,23,26)(H,24,27)(H,25,28) |
| InChIKey | JGGBKMIAXZSHHP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|