C12H15N3O3 — CID 108503318
N-(2-carbamoylphenyl)-N'-propan-2-yloxamide (PubChem CID 108503318) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-N'-propan-2-yloxamide.
| Compound Name | N-(2-carbamoylphenyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503318 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(2-carbamoylphenyl)-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C12H15N3O3/c1-7(2)14-11(17)12(18)15-9-6-4-3-5-8(9)10(13)16/h3-7H,1-2H3,(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | IIRWGJIMCNUMFY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|