C13H12N4O4 — CID 48528626
N-(2-carbamoylphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 48528626) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-(2-carbamoylphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 48528626 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(2-carbamoylphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccccc2C(N)=O)no1 |
| InChI | InChI=1S/C13H12N4O4/c1-7-6-10(17-21-7)16-13(20)12(19)15-9-5-3-2-4-8(9)11(14)18/h2-6H,1H3,(H2,14,18)(H,15,19)(H,16,17,20) |
| InChIKey | SDAYFFVUOQOVKK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|