C16H18N4O3 — CID 51080556
N'-(5-methyl-1,2-oxazol-3-yl)-N-(2-pyrrolidin-1-ylphenyl)oxamide (PubChem CID 51080556) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is N'-(5-methyl-1,2-oxazol-3-yl)-N-(2-pyrrolidin-1-ylphenyl)oxamide.
| Compound Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(2-pyrrolidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 51080556 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(2-pyrrolidin-1-ylphenyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccccc2N2CCCC2)no1 |
| InChI | InChI=1S/C16H18N4O3/c1-11-10-14(19-23-11)18-16(22)15(21)17-12-6-2-3-7-13(12)20-8-4-5-9-20/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,17,21)(H,18,19,22) |
| InChIKey | PFNYFPUXMGWMGA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|