C7H9N3O3 — CID 44996069
N-methyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 44996069) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is N-methyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-methyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 44996069 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N-methyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | CNC(=O)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C7H9N3O3/c1-4-3-5(10-13-4)9-7(12)6(11)8-2/h3H,1-2H3,(H,8,11)(H,9,10,12) |
| InChIKey | OJWLMWXFKYKPPA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|