C10H15N3O3 — CID 44996041
N'-butan-2-yl-N-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 44996041) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N'-butan-2-yl-N-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N'-butan-2-yl-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 44996041 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N'-butan-2-yl-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | CCC(C)NC(=O)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C10H15N3O3/c1-4-6(2)11-9(14)10(15)12-8-5-7(3)16-13-8/h5-6H,4H2,1-3H3,(H,11,14)(H,12,13,15) |
| InChIKey | YIOAPIVXCWOABW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|