C16H19N3O3 — CID 51959353
N'-[(1S)-1-(4-ethylphenyl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 51959353) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N'-[(1S)-1-(4-ethylphenyl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N'-[(1S)-1-(4-ethylphenyl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 51959353 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N'-[(1S)-1-(4-ethylphenyl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | CCc1ccc([C@H](C)NC(=O)C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-4-12-5-7-13(8-6-12)11(3)17-15(20)16(21)18-14-9-10(2)22-19-14/h5-9,11H,4H2,1-3H3,(H,17,20)(H,18,19,21)/t11-/m0/s1 |
| InChIKey | WCLPFCNUNRSWIS-NSHDSACASA-N |
| XLogP | 2.36 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|