C19H21BrN2O2 — CID 108511113
N-(4-bromo-2-methylphenyl)-N'-[1-(4-ethylphenyl)ethyl]oxamide (PubChem CID 108511113) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N'-[1-(4-ethylphenyl)ethyl]oxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-N'-[1-(4-ethylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511113 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N'-[1-(4-ethylphenyl)ethyl]oxamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(=O)Nc2ccc(Br)cc2C)cc1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-4-14-5-7-15(8-6-14)13(3)21-18(23)19(24)22-17-10-9-16(20)11-12(17)2/h5-11,13H,4H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | BVUBCHPOBCOKNS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|