C20H18F6N2O2 — CID 108511055
N-[3,5-bis(trifluoromethyl)phenyl]-N'-[1-(4-ethylphenyl)ethyl]oxamide (PubChem CID 108511055) has the molecular formula C20H18F6N2O2 and a molecular weight of 432.36 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N'-[1-(4-ethylphenyl)ethyl]oxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N'-[1-(4-ethylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511055 |
| Molecular Formula | C20H18F6N2O2 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N'-[1-(4-ethylphenyl)ethyl]oxamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H18F6N2O2/c1-3-12-4-6-13(7-5-12)11(2)27-17(29)18(30)28-16-9-14(19(21,22)23)8-15(10-16)20(24,25)26/h4-11H,3H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | BPLIMCGFTZSQSC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|