C17H18BrClN2S — CID 17300793
1-(4-bromo-2-chlorophenyl)-3-[1-(4-ethylphenyl)ethyl]thiourea (PubChem CID 17300793) has the molecular formula C17H18BrClN2S and a molecular weight of 397.77 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[1-(4-ethylphenyl)ethyl]thiourea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[1-(4-ethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 17300793 |
| Molecular Formula | C17H18BrClN2S |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[1-(4-ethylphenyl)ethyl]thiourea |
| SMILES | CCc1ccc(C(C)NC(=S)Nc2ccc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18BrClN2S/c1-3-12-4-6-13(7-5-12)11(2)20-17(22)21-16-9-8-14(18)10-15(16)19/h4-11H,3H2,1-2H3,(H2,20,21,22) |
| InChIKey | SIGCCRXOAPKMQM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|