C10H16N2O2 — CID 670809
(2S)-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)pentanamide (PubChem CID 670809) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2S)-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)pentanamide.
| Compound Name | (2S)-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)pentanamide |
|---|---|
| PubChem CID | 670809 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2S)-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)pentanamide |
| SMILES | CCC[C@H](C)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C10H16N2O2/c1-4-5-7(2)10(13)11-9-6-8(3)14-12-9/h6-7H,4-5H2,1-3H3,(H,11,12,13)/t7-/m0/s1 |
| InChIKey | MNDZDRPDTAMSLS-ZETCQYMHSA-N |
| XLogP | 2.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |